C12H18N2O6 — CID 9015305
1-O-ethyl 4-O-[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] (E)-but-2-enedioate (PubChem CID 9015305) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 9015305 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-O-ethyl 4-O-[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] (E)-but-2-enedioate |
| SMILES | CCNC(=O)CNC(=O)COC(=O)/C=C/C(=O)OCC |
| InChI | InChI=1S/C12H18N2O6/c1-3-13-9(15)7-14-10(16)8-20-12(18)6-5-11(17)19-4-2/h5-6H,3-4,7-8H2,1-2H3,(H,13,15)(H,14,16)/b6-5+ |
| InChIKey | ZUMSZLYGZOAMIF-AATRIKPKSA-N |
| XLogP | -1.10 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|