C12H18N2O6 — CID 6054436
1-O-ethyl 4-O-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (E)-but-2-enedioate (PubChem CID 6054436) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 6054436 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-O-ethyl 4-O-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCC(=O)NC(=O)NC(C)C |
| InChI | InChI=1S/C12H18N2O6/c1-4-19-10(16)5-6-11(17)20-7-9(15)14-12(18)13-8(2)3/h5-6,8H,4,7H2,1-3H3,(H2,13,14,15,18)/b6-5+ |
| InChIKey | NEIMIMBMRSMYGA-AATRIKPKSA-N |
| XLogP | -0.12 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|