C13H24N4O5 — CID 4832385
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(carbamoylamino)-4-methylpentanoate (PubChem CID 4832385) has the molecular formula C13H24N4O5 and a molecular weight of 316.36 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(carbamoylamino)-4-methylpentanoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(carbamoylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 4832385 |
| Molecular Formula | C13H24N4O5 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(carbamoylamino)-4-methylpentanoate |
| SMILES | CC(C)CC(NC(N)=O)C(=O)OCC(=O)NC(=O)NC(C)C |
| InChI | InChI=1S/C13H24N4O5/c1-7(2)5-9(16-12(14)20)11(19)22-6-10(18)17-13(21)15-8(3)4/h7-9H,5-6H2,1-4H3,(H3,14,16,20)(H2,15,17,18,21) |
| InChIKey | OYVPVMMLGSMGGT-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |