C17H25N3O4 — CID 2409784
[2-[(4-methylphenyl)methylamino]-2-oxoethyl] (2R)-2-(carbamoylamino)-4-methylpentanoate (PubChem CID 2409784) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is [2-[(4-methylphenyl)methylamino]-2-oxoethyl] (2R)-2-(carbamoylamino)-4-methylpentanoate.
| Compound Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] (2R)-2-(carbamoylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 2409784 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] (2R)-2-(carbamoylamino)-4-methylpentanoate |
| SMILES | Cc1ccc(CNC(=O)COC(=O)[C@@H](CC(C)C)NC(N)=O)cc1 |
| InChI | InChI=1S/C17H25N3O4/c1-11(2)8-14(20-17(18)23)16(22)24-10-15(21)19-9-13-6-4-12(3)5-7-13/h4-7,11,14H,8-10H2,1-3H3,(H,19,21)(H3,18,20,23)/t14-/m1/s1 |
| InChIKey | PZXYLQZINFCJKT-CQSZACIVSA-N |
| XLogP | 1.24 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |