C18H25N3O6 — CID 7990905
ethyl 2-[[2-[(2R)-2-(carbamoylamino)-4-methylpentanoyl]oxyacetyl]amino]benzoate (PubChem CID 7990905) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is ethyl 2-[[2-[(2R)-2-(carbamoylamino)-4-methylpentanoyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[(2R)-2-(carbamoylamino)-4-methylpentanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7990905 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | ethyl 2-[[2-[(2R)-2-(carbamoylamino)-4-methylpentanoyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)COC(=O)[C@@H](CC(C)C)NC(N)=O |
| InChI | InChI=1S/C18H25N3O6/c1-4-26-16(23)12-7-5-6-8-13(12)20-15(22)10-27-17(24)14(9-11(2)3)21-18(19)25/h5-8,11,14H,4,9-10H2,1-3H3,(H,20,22)(H3,19,21,25)/t14-/m1/s1 |
| InChIKey | VYSCJMJYULYGSV-CQSZACIVSA-N |
| XLogP | 1.43 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |