C11H21N3O4 — CID 62013338
ethyl 2-[methyl-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]amino]acetate (PubChem CID 62013338) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl 2-[methyl-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]amino]acetate.
| Compound Name | ethyl 2-[methyl-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]amino]acetate |
|---|---|
| PubChem CID | 62013338 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | ethyl 2-[methyl-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(C)CC(=O)NC(=O)NC(C)C |
| InChI | InChI=1S/C11H21N3O4/c1-5-18-10(16)7-14(4)6-9(15)13-11(17)12-8(2)3/h8H,5-7H2,1-4H3,(H2,12,13,15,17) |
| InChIKey | KOEHJIQTYOLBMC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |