C23H29ClN2O3S — CID 90154279
(2R,4S)-5-[(4-chlorophenyl)sulfinylamino]-2-ethyl-4-hydroxy-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide (PubChem CID 90154279) has the molecular formula C23H29ClN2O3S and a molecular weight of 449.02 g/mol. Its IUPAC name is (2R,4S)-5-[(4-chlorophenyl)sulfinylamino]-2-ethyl-4-hydroxy-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide.
| Compound Name | (2R,4S)-5-[(4-chlorophenyl)sulfinylamino]-2-ethyl-4-hydroxy-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
|---|---|
| PubChem CID | 90154279 |
| Molecular Formula | C23H29ClN2O3S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (2R,4S)-5-[(4-chlorophenyl)sulfinylamino]-2-ethyl-4-hydroxy-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pentanamide |
| SMILES | CC[C@H](C[C@H](O)CNS(=O)c1ccc(Cl)cc1)C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C23H29ClN2O3S/c1-2-16(14-19(27)15-25-30(29)20-12-10-18(24)11-13-20)23(28)26-22-9-5-7-17-6-3-4-8-21(17)22/h3-4,6,8,10-13,16,19,22,25,27H,2,5,7,9,14-15H2,1H3,(H,26,28)/t16-,19+,22-,30?/m1/s1 |
| InChIKey | FSFIIBPTIKJXKW-IVJZKJSKSA-N |
| XLogP | 3.92 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |