C13H23F2NO — CID 90155064
2-(3,3-difluorocyclohexyl)-N-pentan-2-ylacetamide (PubChem CID 90155064) has the molecular formula C13H23F2NO and a molecular weight of 247.33 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-N-pentan-2-ylacetamide.
| Compound Name | 2-(3,3-difluorocyclohexyl)-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 90155064 |
| Molecular Formula | C13H23F2NO |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H23F2NO/c1-3-5-10(2)16-12(17)8-11-6-4-7-13(14,15)9-11/h10-11H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | MTVNHZSFVSRWHY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |