C23H29Cl3N4O4 — CID 90155913
tert-butyl 4-[4-methyl-1-phenyl-5-(2,2,2-trichloroethoxycarbonylamino)pyrazol-3-yl]piperidine-1-carboxylate (PubChem CID 90155913) has the molecular formula C23H29Cl3N4O4 and a molecular weight of 531.87 g/mol. Its IUPAC name is tert-butyl 4-[4-methyl-1-phenyl-5-(2,2,2-trichloroethoxycarbonylamino)pyrazol-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-methyl-1-phenyl-5-(2,2,2-trichloroethoxycarbonylamino)pyrazol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90155913 |
| Molecular Formula | C23H29Cl3N4O4 |
| Molecular Weight | 531.87 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | tert-butyl 4-[4-methyl-1-phenyl-5-(2,2,2-trichloroethoxycarbonylamino)pyrazol-3-yl]piperidine-1-carboxylate |
| SMILES | Cc1c(C2CCN(C(=O)OC(C)(C)C)CC2)nn(-c2ccccc2)c1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H29Cl3N4O4/c1-15-18(16-10-12-29(13-11-16)21(32)34-22(2,3)4)28-30(17-8-6-5-7-9-17)19(15)27-20(31)33-14-23(24,25)26/h5-9,16H,10-14H2,1-4H3,(H,27,31) |
| InChIKey | VHLBNEBNEKEQFI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.87 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|