About tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane
tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane (PubChem CID 177339560) has the molecular formula C28H36ClN3O2
and a molecular weight of 482.07 g/mol. Its IUPAC name is tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane |
| PubChem CID | 177339560 |
| Molecular Formula | C28H36ClN3O2 |
| Molecular Weight | 482.07 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane |
| SMILES | CC.Cc1c(C2CCN(C(=O)OC(C)(C)C)CC2)nn(-c2ccccc2)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H30ClN3O2.C2H6/c1-18-23(19-13-15-29(16-14-19)25(31)32-26(2,3)4)28-30(22-11-6-5-7-12-22)24(18)20-9-8-10-21(27)17-20;1-2/h5-12,17,19H,13-16H2,1-4H3;1-2H3 |
| InChIKey | MSCQAVQBXUXGAL-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.07 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane?
The IUPAC name of tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane (CID 177339560) is tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane.
What is the SMILES notation for tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane?
The canonical SMILES for tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane is CC.Cc1c(C2CCN(C(=O)OC(C)(C)C)CC2)nn(-c2ccccc2)c1-c1cccc(Cl)c1.
What is the InChIKey of tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane?
The InChIKey is MSCQAVQBXUXGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30ClN3O2.C2H6/c1-18-23(19-13-15-29(16-14-19)25(31)32-26(2,3)4)28-30(22-11-6-5-7-12-22)24(18)20-9-8-10-21(27)17-20;1-2/h5-12,17,19H,13-16H2,1-4H3;1-2H3.
What are the key properties of tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane?
tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane has a molecular weight of 482.07 g/mol, XLogP of 7.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[5-(3-chlorophenyl)-4-methyl-1-phenylpyrazol-3-yl]piperidine-1-carboxylate;ethane is sourced from PubChem (CID 177339560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).