C16H18ClN3O7 — CID 9015617
[2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate (PubChem CID 9015617) has the molecular formula C16H18ClN3O7 and a molecular weight of 399.79 g/mol. Its IUPAC name is [2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate.
| Compound Name | [2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 9015617 |
| Molecular Formula | C16H18ClN3O7 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
| SMILES | CN(CC(=O)N1CCOCC1)C(=O)COC(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18ClN3O7/c1-18(9-14(21)19-4-6-26-7-5-19)15(22)10-27-16(23)12-3-2-11(17)8-13(12)20(24)25/h2-3,8H,4-7,9-10H2,1H3 |
| InChIKey | NYNZKICUWDLKIO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|