C20H13ClN6O — CID 90157437
3-(6-chloro-3-pyridinyl)-N-(4-cyanophenyl)-N-methylimidazo[1,2-a]pyrazine-6-carboxamide (PubChem CID 90157437) has the molecular formula C20H13ClN6O and a molecular weight of 388.82 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-N-(4-cyanophenyl)-N-methylimidazo[1,2-a]pyrazine-6-carboxamide.
| Compound Name | 3-(6-chloro-3-pyridinyl)-N-(4-cyanophenyl)-N-methylimidazo[1,2-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 90157437 |
| Molecular Formula | C20H13ClN6O |
| Molecular Weight | 388.82 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-N-(4-cyanophenyl)-N-methylimidazo[1,2-a]pyrazine-6-carboxamide |
| SMILES | CN(C(=O)c1cn2c(-c3ccc(Cl)nc3)cnc2cn1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H13ClN6O/c1-26(15-5-2-13(8-22)3-6-15)20(28)16-12-27-17(10-25-19(27)11-23-16)14-4-7-18(21)24-9-14/h2-7,9-12H,1H3 |
| InChIKey | GELPLCWUNHFMSU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.82 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|