C20H13FN6O — CID 90157918
N-(4-cyanophenyl)-3-(6-fluoro-2-pyridinyl)-N-methylimidazo[1,2-a]pyrazine-6-carboxamide (PubChem CID 90157918) has the molecular formula C20H13FN6O and a molecular weight of 372.36 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-(6-fluoro-2-pyridinyl)-N-methylimidazo[1,2-a]pyrazine-6-carboxamide.
| Compound Name | N-(4-cyanophenyl)-3-(6-fluoro-2-pyridinyl)-N-methylimidazo[1,2-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 90157918 |
| Molecular Formula | C20H13FN6O |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-(4-cyanophenyl)-3-(6-fluoro-2-pyridinyl)-N-methylimidazo[1,2-a]pyrazine-6-carboxamide |
| SMILES | CN(C(=O)c1cn2c(-c3cccc(F)n3)cnc2cn1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H13FN6O/c1-26(14-7-5-13(9-22)6-8-14)20(28)16-12-27-17(10-24-19(27)11-23-16)15-3-2-4-18(21)25-15/h2-8,10-12H,1H3 |
| InChIKey | SUKVTOAFPDQFEH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|