C19H23N7O2 — CID 90157873
methyl 3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]cyclopentane-1-carboxylate (PubChem CID 90157873) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is methyl 3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]cyclopentane-1-carboxylate.
| Compound Name | methyl 3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 90157873 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | methyl 3-[[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]amino]cyclopentane-1-carboxylate |
| SMILES | CCn1c(-c2cnc(C)nc2)nc2c(NC3CCC(C(=O)OC)C3)ncnc21 |
| InChI | InChI=1S/C19H23N7O2/c1-4-26-17(13-8-20-11(2)21-9-13)25-15-16(22-10-23-18(15)26)24-14-6-5-12(7-14)19(27)28-3/h8-10,12,14H,4-7H2,1-3H3,(H,22,23,24) |
| InChIKey | DIYOLHXBGOZFKG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |