C17H17F3N6O — CID 90158177
9-ethyl-6-pyrrolidin-3-yloxy-8-[6-(trifluoromethyl)-3-pyridinyl]purine (PubChem CID 90158177) has the molecular formula C17H17F3N6O and a molecular weight of 378.36 g/mol. Its IUPAC name is 9-ethyl-6-pyrrolidin-3-yloxy-8-[6-(trifluoromethyl)-3-pyridinyl]purine.
| Compound Name | 9-ethyl-6-pyrrolidin-3-yloxy-8-[6-(trifluoromethyl)-3-pyridinyl]purine |
|---|---|
| PubChem CID | 90158177 |
| Molecular Formula | C17H17F3N6O |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 9-ethyl-6-pyrrolidin-3-yloxy-8-[6-(trifluoromethyl)-3-pyridinyl]purine |
| SMILES | CCn1c(-c2ccc(C(F)(F)F)nc2)nc2c(OC3CCNC3)ncnc21 |
| InChI | InChI=1S/C17H17F3N6O/c1-2-26-14(10-3-4-12(22-7-10)17(18,19)20)25-13-15(26)23-9-24-16(13)27-11-5-6-21-8-11/h3-4,7,9,11,21H,2,5-6,8H2,1H3 |
| InChIKey | JVIPUTWCLFJXLB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |