C14H21N5O5 — CID 90158460
tert-butyl 3-[6-(methylamino)-5-nitropyrimidin-4-yl]oxypyrrolidine-1-carboxylate (PubChem CID 90158460) has the molecular formula C14H21N5O5 and a molecular weight of 339.35 g/mol. Its IUPAC name is tert-butyl 3-[6-(methylamino)-5-nitropyrimidin-4-yl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-(methylamino)-5-nitropyrimidin-4-yl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90158460 |
| Molecular Formula | C14H21N5O5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl 3-[6-(methylamino)-5-nitropyrimidin-4-yl]oxypyrrolidine-1-carboxylate |
| SMILES | CNc1ncnc(OC2CCN(C(=O)OC(C)(C)C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N5O5/c1-14(2,3)24-13(20)18-6-5-9(7-18)23-12-10(19(21)22)11(15-4)16-8-17-12/h8-9H,5-7H2,1-4H3,(H,15,16,17) |
| InChIKey | ZMPNNAXIIHLPPY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|