C28H33N3O2 — CID 90163549
N-methyl-N-[7-(methylamino)-7-oxoheptyl]-4-(N-phenylanilino)benzamide (PubChem CID 90163549) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-methyl-N-[7-(methylamino)-7-oxoheptyl]-4-(N-phenylanilino)benzamide.
| Compound Name | N-methyl-N-[7-(methylamino)-7-oxoheptyl]-4-(N-phenylanilino)benzamide |
|---|---|
| PubChem CID | 90163549 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | N-methyl-N-[7-(methylamino)-7-oxoheptyl]-4-(N-phenylanilino)benzamide |
| SMILES | CNC(=O)CCCCCCN(C)C(=O)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H33N3O2/c1-29-27(32)17-11-3-4-12-22-30(2)28(33)23-18-20-26(21-19-23)31(24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-10,13-16,18-21H,3-4,11-12,17,22H2,1-2H3,(H,29,32) |
| InChIKey | DEYONHHUCAPVOI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|