C15H13F2IN2O3 — CID 90167195
ethyl 2-(2,2-difluoro-2-pyridin-2-ylethoxy)-4-iodopyridine-3-carboxylate (PubChem CID 90167195) has the molecular formula C15H13F2IN2O3 and a molecular weight of 434.18 g/mol. Its IUPAC name is ethyl 2-(2,2-difluoro-2-pyridin-2-ylethoxy)-4-iodopyridine-3-carboxylate.
| Compound Name | ethyl 2-(2,2-difluoro-2-pyridin-2-ylethoxy)-4-iodopyridine-3-carboxylate |
|---|---|
| PubChem CID | 90167195 |
| Molecular Formula | C15H13F2IN2O3 |
| Molecular Weight | 434.18 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | ethyl 2-(2,2-difluoro-2-pyridin-2-ylethoxy)-4-iodopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(I)ccnc1OCC(F)(F)c1ccccn1 |
| InChI | InChI=1S/C15H13F2IN2O3/c1-2-22-14(21)12-10(18)6-8-20-13(12)23-9-15(16,17)11-5-3-4-7-19-11/h3-8H,2,9H2,1H3 |
| InChIKey | YLWIWCZHPSTVLR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|