C15H23N3O7 — CID 90168515
(4S,7S)-4-amino-7-[[(3S)-1-methyl-5-oxopyrrolidin-3-yl]amino]-5,6-dioxodecanedioic acid (PubChem CID 90168515) has the molecular formula C15H23N3O7 and a molecular weight of 357.36 g/mol. Its IUPAC name is (4S,7S)-4-amino-7-[[(3S)-1-methyl-5-oxopyrrolidin-3-yl]amino]-5,6-dioxodecanedioic acid.
| Compound Name | (4S,7S)-4-amino-7-[[(3S)-1-methyl-5-oxopyrrolidin-3-yl]amino]-5,6-dioxodecanedioic acid |
|---|---|
| PubChem CID | 90168515 |
| Molecular Formula | C15H23N3O7 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (4S,7S)-4-amino-7-[[(3S)-1-methyl-5-oxopyrrolidin-3-yl]amino]-5,6-dioxodecanedioic acid |
| SMILES | CN1C[C@@H](N[C@@H](CCC(=O)O)C(=O)C(=O)[C@@H](N)CCC(=O)O)CC1=O |
| InChI | InChI=1S/C15H23N3O7/c1-18-7-8(6-11(18)19)17-10(3-5-13(22)23)15(25)14(24)9(16)2-4-12(20)21/h8-10,17H,2-7,16H2,1H3,(H,20,21)(H,22,23)/t8-,9-,10-/m0/s1 |
| InChIKey | BJMGYDQBGSYWPU-GUBZILKMSA-N |
| XLogP | -1.63 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|