C20H32N4O6 — CID 90168481
(4S,8S)-7-amino-4-[[(3S)-1-[(2S)-2-formylpyrrolidin-1-yl]-5-oxopyrrolidin-3-yl]amino]-8-methyl-5,6-dioxodecanoic acid (PubChem CID 90168481) has the molecular formula C20H32N4O6 and a molecular weight of 424.50 g/mol. Its IUPAC name is (4S,8S)-7-amino-4-[[(3S)-1-[(2S)-2-formylpyrrolidin-1-yl]-5-oxopyrrolidin-3-yl]amino]-8-methyl-5,6-dioxodecanoic acid.
| Compound Name | (4S,8S)-7-amino-4-[[(3S)-1-[(2S)-2-formylpyrrolidin-1-yl]-5-oxopyrrolidin-3-yl]amino]-8-methyl-5,6-dioxodecanoic acid |
|---|---|
| PubChem CID | 90168481 |
| Molecular Formula | C20H32N4O6 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (4S,8S)-7-amino-4-[[(3S)-1-[(2S)-2-formylpyrrolidin-1-yl]-5-oxopyrrolidin-3-yl]amino]-8-methyl-5,6-dioxodecanoic acid |
| SMILES | CC[C@H](C)C(N)C(=O)C(=O)[C@H](CCC(=O)O)N[C@H]1CC(=O)N(N2CCC[C@H]2C=O)C1 |
| InChI | InChI=1S/C20H32N4O6/c1-3-12(2)18(21)20(30)19(29)15(6-7-17(27)28)22-13-9-16(26)24(10-13)23-8-4-5-14(23)11-25/h11-15,18,22H,3-10,21H2,1-2H3,(H,27,28)/t12-,13-,14-,15-,18?/m0/s1 |
| InChIKey | KGCCUVJMWZLBAU-PJFRXGFKSA-N |
| XLogP | -0.50 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|