C20H38N6O5 — CID 118885405
(4S)-4-[[(2S)-5-(diaminomethylamino)-2-[[(2S)-2-formylpyrrolidin-1-yl]amino]pentanoyl]amino]-6-methyl-5-oxooctanoic acid (PubChem CID 118885405) has the molecular formula C20H38N6O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is (4S)-4-[[(2S)-5-(diaminomethylamino)-2-[[(2S)-2-formylpyrrolidin-1-yl]amino]pentanoyl]amino]-6-methyl-5-oxooctanoic acid.
| Compound Name | (4S)-4-[[(2S)-5-(diaminomethylamino)-2-[[(2S)-2-formylpyrrolidin-1-yl]amino]pentanoyl]amino]-6-methyl-5-oxooctanoic acid |
|---|---|
| PubChem CID | 118885405 |
| Molecular Formula | C20H38N6O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (4S)-4-[[(2S)-5-(diaminomethylamino)-2-[[(2S)-2-formylpyrrolidin-1-yl]amino]pentanoyl]amino]-6-methyl-5-oxooctanoic acid |
| SMILES | CCC(C)C(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCNC(N)N)NN1CCC[C@H]1C=O |
| InChI | InChI=1S/C20H38N6O5/c1-3-13(2)18(30)15(8-9-17(28)29)24-19(31)16(7-4-10-23-20(21)22)25-26-11-5-6-14(26)12-27/h12-16,20,23,25H,3-11,21-22H2,1-2H3,(H,24,31)(H,28,29)/t13?,14-,15-,16-/m0/s1 |
| InChIKey | KNPCXXCKFTYSDL-JFKGFPBSSA-N |
| XLogP | -0.94 |
| TPSA | 179.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|