C22H40N6O9 — CID 167548092
2-[[(2S)-2-formylpyrrolidin-1-yl]amino]-N,N'-bis[2-(2-methoxyethoxymethylamino)-2-oxoethyl]pentanediamide (PubChem CID 167548092) has the molecular formula C22H40N6O9 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-[[(2S)-2-formylpyrrolidin-1-yl]amino]-N,N'-bis[2-(2-methoxyethoxymethylamino)-2-oxoethyl]pentanediamide.
| Compound Name | 2-[[(2S)-2-formylpyrrolidin-1-yl]amino]-N,N'-bis[2-(2-methoxyethoxymethylamino)-2-oxoethyl]pentanediamide |
|---|---|
| PubChem CID | 167548092 |
| Molecular Formula | C22H40N6O9 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 2-[[(2S)-2-formylpyrrolidin-1-yl]amino]-N,N'-bis[2-(2-methoxyethoxymethylamino)-2-oxoethyl]pentanediamide |
| SMILES | COCCOCNC(=O)CNC(=O)CCC(NN1CCC[C@H]1C=O)C(=O)NCC(=O)NCOCCOC |
| InChI | InChI=1S/C22H40N6O9/c1-34-8-10-36-15-25-20(31)12-23-19(30)6-5-18(27-28-7-3-4-17(28)14-29)22(33)24-13-21(32)26-16-37-11-9-35-2/h14,17-18,27H,3-13,15-16H2,1-2H3,(H,23,30)(H,24,33)(H,25,31)(H,26,32)/t17-,18?/m0/s1 |
| InChIKey | XXWKKQVNEQOHQP-ZENAZSQFSA-N |
| XLogP | -2.99 |
| TPSA | 185.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|