C19H35N5O10 — CID 167570790
2-[(2-hydroxyacetyl)amino]-N,N'-bis[2-(2-methoxyethoxymethylamino)-2-oxoethyl]pentanediamide (PubChem CID 167570790) has the molecular formula C19H35N5O10 and a molecular weight of 493.51 g/mol. Its IUPAC name is 2-[(2-hydroxyacetyl)amino]-N,N'-bis[2-(2-methoxyethoxymethylamino)-2-oxoethyl]pentanediamide.
| Compound Name | 2-[(2-hydroxyacetyl)amino]-N,N'-bis[2-(2-methoxyethoxymethylamino)-2-oxoethyl]pentanediamide |
|---|---|
| PubChem CID | 167570790 |
| Molecular Formula | C19H35N5O10 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 2-[(2-hydroxyacetyl)amino]-N,N'-bis[2-(2-methoxyethoxymethylamino)-2-oxoethyl]pentanediamide |
| SMILES | COCCOCNC(=O)CNC(=O)CCC(NC(=O)CO)C(=O)NCC(=O)NCOCCOC |
| InChI | InChI=1S/C19H35N5O10/c1-31-5-7-33-12-22-16(27)9-20-15(26)4-3-14(24-18(29)11-25)19(30)21-10-17(28)23-13-34-8-6-32-2/h14,25H,3-13H2,1-2H3,(H,20,26)(H,21,30)(H,22,27)(H,23,28)(H,24,29) |
| InChIKey | VCWGKECZYLHIHG-UHFFFAOYSA-N |
| XLogP | -4.05 |
| TPSA | 202.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|