C15H33N5O4 — CID 155773621
2-amino-N'-[2-(2-aminoethylamino)ethyl]-N-[3-(2-methoxyethoxy)propyl]pentanediamide (PubChem CID 155773621) has the molecular formula C15H33N5O4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-amino-N'-[2-(2-aminoethylamino)ethyl]-N-[3-(2-methoxyethoxy)propyl]pentanediamide.
| Compound Name | 2-amino-N'-[2-(2-aminoethylamino)ethyl]-N-[3-(2-methoxyethoxy)propyl]pentanediamide |
|---|---|
| PubChem CID | 155773621 |
| Molecular Formula | C15H33N5O4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 2-amino-N'-[2-(2-aminoethylamino)ethyl]-N-[3-(2-methoxyethoxy)propyl]pentanediamide |
| SMILES | COCCOCCCNC(=O)C(N)CCC(=O)NCCNCCN |
| InChI | InChI=1S/C15H33N5O4/c1-23-11-12-24-10-2-6-20-15(22)13(17)3-4-14(21)19-9-8-18-7-5-16/h13,18H,2-12,16-17H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | OEDMAQYODALRFE-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|