C15H17Cl3F3N3 — CID 90169763
4-[5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]piperidine;dihydrochloride (PubChem CID 90169763) has the molecular formula C15H17Cl3F3N3 and a molecular weight of 402.68 g/mol. Its IUPAC name is 4-[5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]piperidine;dihydrochloride.
| Compound Name | 4-[5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]piperidine;dihydrochloride |
|---|---|
| PubChem CID | 90169763 |
| Molecular Formula | C15H17Cl3F3N3 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 4-[5-[4-chloro-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]piperidine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)c1cc(-c2cnc(C3CCNCC3)[nH]2)ccc1Cl |
| InChI | InChI=1S/C15H15ClF3N3.2ClH/c16-12-2-1-10(7-11(12)15(17,18)19)13-8-21-14(22-13)9-3-5-20-6-4-9;;/h1-2,7-9,20H,3-6H2,(H,21,22);2*1H |
| InChIKey | LRCFKXGCPFPTRV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |