C18H21F3OSi — CID 90172221
hydroxy-di(propan-2-yl)-[4-(2,4,6-trifluorophenyl)phenyl]silane (PubChem CID 90172221) has the molecular formula C18H21F3OSi and a molecular weight of 338.45 g/mol. Its IUPAC name is hydroxy-di(propan-2-yl)-[4-(2,4,6-trifluorophenyl)phenyl]silane.
| Compound Name | hydroxy-di(propan-2-yl)-[4-(2,4,6-trifluorophenyl)phenyl]silane |
|---|---|
| PubChem CID | 90172221 |
| Molecular Formula | C18H21F3OSi |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | hydroxy-di(propan-2-yl)-[4-(2,4,6-trifluorophenyl)phenyl]silane |
| SMILES | CC(C)[Si](O)(c1ccc(-c2c(F)cc(F)cc2F)cc1)C(C)C |
| InChI | InChI=1S/C18H21F3OSi/c1-11(2)23(22,12(3)4)15-7-5-13(6-8-15)18-16(20)9-14(19)10-17(18)21/h5-12,22H,1-4H3 |
| InChIKey | FELNWXMMWJCBBZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|