About CID 90174844
CID 90174844 (PubChem CID 90174844) has the molecular formula C17H15F4OSi
and a molecular weight of 339.38 g/mol.
Molecular Properties
| Compound Name | CID 90174844 |
| PubChem CID | 90174844 |
| Molecular Formula | C17H15F4OSi |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | — |
| SMILES | CCC(CC)(O[Si])c1ccc(-c2cc(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H15F4OSi/c1-3-17(4-2,22-23)11-7-5-10(6-8-11)12-9-13(18)15(20)16(21)14(12)19/h5-9H,3-4H2,1-2H3 |
| InChIKey | VBAJNUWUIIJRHF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90174844 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90174844?
The IUPAC name of CID 90174844 (CID 90174844) is not available.
What is the SMILES notation for CID 90174844?
The canonical SMILES for CID 90174844 is CCC(CC)(O[Si])c1ccc(-c2cc(F)c(F)c(F)c2F)cc1.
What is the InChIKey of CID 90174844?
The InChIKey is VBAJNUWUIIJRHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F4OSi/c1-3-17(4-2,22-23)11-7-5-10(6-8-11)12-9-13(18)15(20)16(21)14(12)19/h5-9H,3-4H2,1-2H3.
What are the key properties of CID 90174844?
CID 90174844 has a molecular weight of 339.38 g/mol, XLogP of 5.03, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90174844 is sourced from PubChem (CID 90174844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).