C20H17F3N4O — CID 90178083
2-(methoxymethyl)-1-[3-[4-(trifluoromethyl)phenyl]-4H-pyrimidin-2-yl]benzimidazole (PubChem CID 90178083) has the molecular formula C20H17F3N4O and a molecular weight of 386.38 g/mol. Its IUPAC name is 2-(methoxymethyl)-1-[3-[4-(trifluoromethyl)phenyl]-4H-pyrimidin-2-yl]benzimidazole.
| Compound Name | 2-(methoxymethyl)-1-[3-[4-(trifluoromethyl)phenyl]-4H-pyrimidin-2-yl]benzimidazole |
|---|---|
| PubChem CID | 90178083 |
| Molecular Formula | C20H17F3N4O |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-(methoxymethyl)-1-[3-[4-(trifluoromethyl)phenyl]-4H-pyrimidin-2-yl]benzimidazole |
| SMILES | COCc1nc2ccccc2n1C1=NC=CCN1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N4O/c1-28-13-18-25-16-5-2-3-6-17(16)27(18)19-24-11-4-12-26(19)15-9-7-14(8-10-15)20(21,22)23/h2-11H,12-13H2,1H3 |
| InChIKey | LYPZKVBHBHXIBV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |