C19H15ClF2N4O — CID 90178068
6-chloro-1-[3-[4-(difluoromethoxy)phenyl]-4H-pyrimidin-2-yl]-2-methylbenzimidazole (PubChem CID 90178068) has the molecular formula C19H15ClF2N4O and a molecular weight of 388.81 g/mol. Its IUPAC name is 6-chloro-1-[3-[4-(difluoromethoxy)phenyl]-4H-pyrimidin-2-yl]-2-methylbenzimidazole.
| Compound Name | 6-chloro-1-[3-[4-(difluoromethoxy)phenyl]-4H-pyrimidin-2-yl]-2-methylbenzimidazole |
|---|---|
| PubChem CID | 90178068 |
| Molecular Formula | C19H15ClF2N4O |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 6-chloro-1-[3-[4-(difluoromethoxy)phenyl]-4H-pyrimidin-2-yl]-2-methylbenzimidazole |
| SMILES | Cc1nc2ccc(Cl)cc2n1C1=NC=CCN1c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H15ClF2N4O/c1-12-24-16-8-3-13(20)11-17(16)26(12)19-23-9-2-10-25(19)14-4-6-15(7-5-14)27-18(21)22/h2-9,11,18H,10H2,1H3 |
| InChIKey | ZGSDWVQJIWDPTL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |