C25H28ClN3O5 — CID 90178141
tert-butyl 4-[4-[[2-(2-chlorophenyl)acetyl]amino]-2-(2-methoxyethoxy)phenyl]pyrazole-1-carboxylate (PubChem CID 90178141) has the molecular formula C25H28ClN3O5 and a molecular weight of 485.97 g/mol. Its IUPAC name is tert-butyl 4-[4-[[2-(2-chlorophenyl)acetyl]amino]-2-(2-methoxyethoxy)phenyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[2-(2-chlorophenyl)acetyl]amino]-2-(2-methoxyethoxy)phenyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 90178141 |
| Molecular Formula | C25H28ClN3O5 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | tert-butyl 4-[4-[[2-(2-chlorophenyl)acetyl]amino]-2-(2-methoxyethoxy)phenyl]pyrazole-1-carboxylate |
| SMILES | COCCOc1cc(NC(=O)Cc2ccccc2Cl)ccc1-c1cnn(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H28ClN3O5/c1-25(2,3)34-24(31)29-16-18(15-27-29)20-10-9-19(14-22(20)33-12-11-32-4)28-23(30)13-17-7-5-6-8-21(17)26/h5-10,14-16H,11-13H2,1-4H3,(H,28,30) |
| InChIKey | KOLVZRZRUQVMIJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|