C24H20ClNO4 — CID 90179814
tert-butyl 4-[(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl]benzoate (PubChem CID 90179814) has the molecular formula C24H20ClNO4 and a molecular weight of 421.88 g/mol. Its IUPAC name is tert-butyl 4-[(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl]benzoate.
| Compound Name | tert-butyl 4-[(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 90179814 |
| Molecular Formula | C24H20ClNO4 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | tert-butyl 4-[(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CN2C(=O)c3cccc4c(Cl)ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C24H20ClNO4/c1-24(2,3)30-23(29)15-9-7-14(8-10-15)13-26-21(27)17-6-4-5-16-19(25)12-11-18(20(16)17)22(26)28/h4-12H,13H2,1-3H3 |
| InChIKey | JHWTZAPTUDKGBW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|