C16H24N2O8 — CID 90180797
(6-methoxy-3,5-dioxoheptan-2-yl) 3-oxo-3-[(3-oxobutanoylamino)methylamino]propanoate (PubChem CID 90180797) has the molecular formula C16H24N2O8 and a molecular weight of 372.37 g/mol. Its IUPAC name is (6-methoxy-3,5-dioxoheptan-2-yl) 3-oxo-3-[(3-oxobutanoylamino)methylamino]propanoate.
| Compound Name | (6-methoxy-3,5-dioxoheptan-2-yl) 3-oxo-3-[(3-oxobutanoylamino)methylamino]propanoate |
|---|---|
| PubChem CID | 90180797 |
| Molecular Formula | C16H24N2O8 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (6-methoxy-3,5-dioxoheptan-2-yl) 3-oxo-3-[(3-oxobutanoylamino)methylamino]propanoate |
| SMILES | COC(C)C(=O)CC(=O)C(C)OC(=O)CC(=O)NCNC(=O)CC(C)=O |
| InChI | InChI=1S/C16H24N2O8/c1-9(19)5-14(22)17-8-18-15(23)7-16(24)26-11(3)13(21)6-12(20)10(2)25-4/h10-11H,5-8H2,1-4H3,(H,17,22)(H,18,23) |
| InChIKey | ITCBPEMXSGUWCZ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|