C16H27N3O9 — CID 167615901
methoxymethyl 3-oxo-3-[(3-oxobutanoylamino)methylamino]propanoate;2-methoxy-N-(2-oxopropyl)acetamide (PubChem CID 167615901) has the molecular formula C16H27N3O9 and a molecular weight of 405.40 g/mol. Its IUPAC name is methoxymethyl 3-oxo-3-[(3-oxobutanoylamino)methylamino]propanoate;2-methoxy-N-(2-oxopropyl)acetamide.
| Compound Name | methoxymethyl 3-oxo-3-[(3-oxobutanoylamino)methylamino]propanoate;2-methoxy-N-(2-oxopropyl)acetamide |
|---|---|
| PubChem CID | 167615901 |
| Molecular Formula | C16H27N3O9 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | methoxymethyl 3-oxo-3-[(3-oxobutanoylamino)methylamino]propanoate;2-methoxy-N-(2-oxopropyl)acetamide |
| SMILES | COCC(=O)NCC(C)=O.COCOC(=O)CC(=O)NCNC(=O)CC(C)=O |
| InChI | InChI=1S/C10H16N2O6.C6H11NO3/c1-7(13)3-8(14)11-5-12-9(15)4-10(16)18-6-17-2;1-5(8)3-7-6(9)4-10-2/h3-6H2,1-2H3,(H,11,14)(H,12,15);3-4H2,1-2H3,(H,7,9) |
| InChIKey | LSSYZHWIOVOUFC-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 166.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|