C19H18FN7O — CID 90182221
2-(6-amino-2-methylbenzimidazol-1-yl)-5-fluoro-4-N-(4-methoxyphenyl)pyrimidine-4,6-diamine (PubChem CID 90182221) has the molecular formula C19H18FN7O and a molecular weight of 379.40 g/mol. Its IUPAC name is 2-(6-amino-2-methylbenzimidazol-1-yl)-5-fluoro-4-N-(4-methoxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-(6-amino-2-methylbenzimidazol-1-yl)-5-fluoro-4-N-(4-methoxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 90182221 |
| Molecular Formula | C19H18FN7O |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-(6-amino-2-methylbenzimidazol-1-yl)-5-fluoro-4-N-(4-methoxyphenyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(Nc2nc(-n3c(C)nc4ccc(N)cc43)nc(N)c2F)cc1 |
| InChI | InChI=1S/C19H18FN7O/c1-10-23-14-8-3-11(21)9-15(14)27(10)19-25-17(22)16(20)18(26-19)24-12-4-6-13(28-2)7-5-12/h3-9H,21H2,1-2H3,(H3,22,24,25,26) |
| InChIKey | NFMRRBGTCRGCDG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|