C20H16FN7 — CID 123164424
5-fluoro-2-(6-isocyano-2-methylbenzimidazol-1-yl)-4-N-(4-methylphenyl)pyrimidine-4,6-diamine (PubChem CID 123164424) has the molecular formula C20H16FN7 and a molecular weight of 373.40 g/mol. Its IUPAC name is 5-fluoro-2-(6-isocyano-2-methylbenzimidazol-1-yl)-4-N-(4-methylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 5-fluoro-2-(6-isocyano-2-methylbenzimidazol-1-yl)-4-N-(4-methylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 123164424 |
| Molecular Formula | C20H16FN7 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 5-fluoro-2-(6-isocyano-2-methylbenzimidazol-1-yl)-4-N-(4-methylphenyl)pyrimidine-4,6-diamine |
| SMILES | [C-]#[N+]c1ccc2nc(C)n(-c3nc(N)c(F)c(Nc4ccc(C)cc4)n3)c2c1 |
| InChI | InChI=1S/C20H16FN7/c1-11-4-6-13(7-5-11)25-19-17(21)18(22)26-20(27-19)28-12(2)24-15-9-8-14(23-3)10-16(15)28/h4-10H,1-2H3,(H3,22,25,26,27) |
| InChIKey | ICLASFJFNCPHBL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|