About 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine
6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 122425052) has the molecular formula C20H20N6
and a molecular weight of 344.42 g/mol. Its IUPAC name is 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine |
| PubChem CID | 122425052 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N)cc(-n3c(C)nc4ccc(C)cc43)n2)cc1 |
| InChI | InChI=1S/C20H20N6/c1-12-4-7-15(8-5-12)23-20-24-18(21)11-19(25-20)26-14(3)22-16-9-6-13(2)10-17(16)26/h4-11H,1-3H3,(H3,21,23,24,25) |
| InChIKey | NAQTYDYQOONZIX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine?
The IUPAC name of 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine (CID 122425052) is 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine?
The canonical SMILES for 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine is Cc1ccc(Nc2nc(N)cc(-n3c(C)nc4ccc(C)cc43)n2)cc1.
What is the InChIKey of 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine?
The InChIKey is NAQTYDYQOONZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N6/c1-12-4-7-15(8-5-12)23-20-24-18(21)11-19(25-20)26-14(3)22-16-9-6-13(2)10-17(16)26/h4-11H,1-3H3,(H3,21,23,24,25).
What are the key properties of 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine?
6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine has a molecular weight of 344.42 g/mol, XLogP of 4.07, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dimethylbenzimidazol-1-yl)-2-N-(4-methylphenyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 122425052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).