C15H14BrNO4S — CID 9019108
[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 9019108) has the molecular formula C15H14BrNO4S and a molecular weight of 384.25 g/mol. Its IUPAC name is [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9019108 |
| Molecular Formula | C15H14BrNO4S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | CN(Cc1ccsc1)C(=O)COC(=O)/C=C/c1ccc(Br)o1 |
| InChI | InChI=1S/C15H14BrNO4S/c1-17(8-11-6-7-22-10-11)14(18)9-20-15(19)5-3-12-2-4-13(16)21-12/h2-7,10H,8-9H2,1H3/b5-3+ |
| InChIKey | UBTGWWNIZYFBNS-HWKANZROSA-N |
| XLogP | 3.32 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|