C17H19N3O4S — CID 90191188
tert-butyl 3-[hydroxy-(5-oxo-2-sulfanylideneimidazolidin-4-yl)methyl]indole-1-carboxylate (PubChem CID 90191188) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is tert-butyl 3-[hydroxy-(5-oxo-2-sulfanylideneimidazolidin-4-yl)methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[hydroxy-(5-oxo-2-sulfanylideneimidazolidin-4-yl)methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 90191188 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | tert-butyl 3-[hydroxy-(5-oxo-2-sulfanylideneimidazolidin-4-yl)methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(O)C2NC(=S)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C17H19N3O4S/c1-17(2,3)24-16(23)20-8-10(9-6-4-5-7-11(9)20)13(21)12-14(22)19-15(25)18-12/h4-8,12-13,21H,1-3H3,(H2,18,19,22,25) |
| InChIKey | APNBHJZZJGIVDT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|