C43H22F10N2 — CID 90193979
2,3,5,6-tetrafluoro-N-(4-fluorophenyl)-N-[4-[9-(4-methylphenyl)carbazol-3-yl]phenyl]-4-(2,3,4,5,6-pentafluorophenyl)aniline (PubChem CID 90193979) has the molecular formula C43H22F10N2 and a molecular weight of 756.64 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(4-fluorophenyl)-N-[4-[9-(4-methylphenyl)carbazol-3-yl]phenyl]-4-(2,3,4,5,6-pentafluorophenyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-(4-fluorophenyl)-N-[4-[9-(4-methylphenyl)carbazol-3-yl]phenyl]-4-(2,3,4,5,6-pentafluorophenyl)aniline |
|---|---|
| PubChem CID | 90193979 |
| Molecular Formula | C43H22F10N2 |
| Molecular Weight | 756.64 g/mol |
| Exact Mass | 756.16 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(4-fluorophenyl)-N-[4-[9-(4-methylphenyl)carbazol-3-yl]phenyl]-4-(2,3,4,5,6-pentafluorophenyl)aniline |
| SMILES | Cc1ccc(-n2c3ccccc3c3cc(-c4ccc(N(c5ccc(F)cc5)c5c(F)c(F)c(-c6c(F)c(F)c(F)c(F)c6F)c(F)c5F)cc4)ccc32)cc1 |
| InChI | InChI=1S/C43H22F10N2/c1-21-6-13-27(14-7-21)55-30-5-3-2-4-28(30)29-20-23(10-19-31(29)55)22-8-15-25(16-9-22)54(26-17-11-24(44)12-18-26)43-41(52)36(47)33(37(48)42(43)53)32-34(45)38(49)40(51)39(50)35(32)46/h2-20H,1H3 |
| InChIKey | RQPBVHDFKUZULN-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.64 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|