C52H27F9N2 — CID 90194010
2,3,5,6-tetrafluoro-N-[4-(9-naphthalen-2-ylcarbazol-3-yl)phenyl]-4-(2,3,4,5,6-pentafluorophenyl)-N-(4-phenylphenyl)aniline (PubChem CID 90194010) has the molecular formula C52H27F9N2 and a molecular weight of 850.78 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[4-(9-naphthalen-2-ylcarbazol-3-yl)phenyl]-4-(2,3,4,5,6-pentafluorophenyl)-N-(4-phenylphenyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[4-(9-naphthalen-2-ylcarbazol-3-yl)phenyl]-4-(2,3,4,5,6-pentafluorophenyl)-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 90194010 |
| Molecular Formula | C52H27F9N2 |
| Molecular Weight | 850.78 g/mol |
| Exact Mass | 850.20 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[4-(9-naphthalen-2-ylcarbazol-3-yl)phenyl]-4-(2,3,4,5,6-pentafluorophenyl)-N-(4-phenylphenyl)aniline |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccc5ccccc5c4)cc3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C52H27F9N2/c53-43-41(44(54)48(58)49(59)47(43)57)42-45(55)50(60)52(51(61)46(42)56)62(34-20-14-30(15-21-34)28-8-2-1-3-9-28)35-22-16-31(17-23-35)33-19-25-40-38(27-33)37-12-6-7-13-39(37)63(40)36-24-18-29-10-4-5-11-32(29)26-36/h1-27H |
| InChIKey | KYWMKPHYSNSQIH-UHFFFAOYSA-N |
| XLogP | 15.66 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.78 |
| LogP ≤ 5 | 15.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|