C28H22F2N4O4 — CID 90197303
N-[[(11Z)-11-(1-cyanoethylidene)-3-fluoro-6H-benzo[c][1]benzoxepin-8-yl]methyl]-N-(6-fluoro-2-nitro-3-pyridinyl)cyclobutanecarboxamide (PubChem CID 90197303) has the molecular formula C28H22F2N4O4 and a molecular weight of 516.50 g/mol. Its IUPAC name is N-[[(11Z)-11-(1-cyanoethylidene)-3-fluoro-6H-benzo[c][1]benzoxepin-8-yl]methyl]-N-(6-fluoro-2-nitro-3-pyridinyl)cyclobutanecarboxamide.
| Compound Name | N-[[(11Z)-11-(1-cyanoethylidene)-3-fluoro-6H-benzo[c][1]benzoxepin-8-yl]methyl]-N-(6-fluoro-2-nitro-3-pyridinyl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 90197303 |
| Molecular Formula | C28H22F2N4O4 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | N-[[(11Z)-11-(1-cyanoethylidene)-3-fluoro-6H-benzo[c][1]benzoxepin-8-yl]methyl]-N-(6-fluoro-2-nitro-3-pyridinyl)cyclobutanecarboxamide |
| SMILES | C/C(C#N)=C1\c2ccc(CN(C(=O)C3CCC3)c3ccc(F)nc3[N+](=O)[O-])cc2COc2cc(F)ccc21 |
| InChI | InChI=1S/C28H22F2N4O4/c1-16(13-31)26-21-7-5-17(11-19(21)15-38-24-12-20(29)6-8-22(24)26)14-33(28(35)18-3-2-4-18)23-9-10-25(30)32-27(23)34(36)37/h5-12,18H,2-4,14-15H2,1H3/b26-16- |
| InChIKey | MSRMDTJYESOJDR-QQXSKIMKSA-N |
| XLogP | 5.84 |
| TPSA | 109.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|