C31H28FN3OSi — CID 90197693
(2Z)-2-[3-fluoro-8-[[2-methyl-7-(2-trimethylsilylethynyl)imidazo[1,2-a]pyridin-3-yl]methyl]-6H-benzo[c][1]benzoxepin-11-ylidene]propanenitrile (PubChem CID 90197693) has the molecular formula C31H28FN3OSi and a molecular weight of 505.67 g/mol. Its IUPAC name is (2Z)-2-[3-fluoro-8-[[2-methyl-7-(2-trimethylsilylethynyl)imidazo[1,2-a]pyridin-3-yl]methyl]-6H-benzo[c][1]benzoxepin-11-ylidene]propanenitrile.
| Compound Name | (2Z)-2-[3-fluoro-8-[[2-methyl-7-(2-trimethylsilylethynyl)imidazo[1,2-a]pyridin-3-yl]methyl]-6H-benzo[c][1]benzoxepin-11-ylidene]propanenitrile |
|---|---|
| PubChem CID | 90197693 |
| Molecular Formula | C31H28FN3OSi |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | (2Z)-2-[3-fluoro-8-[[2-methyl-7-(2-trimethylsilylethynyl)imidazo[1,2-a]pyridin-3-yl]methyl]-6H-benzo[c][1]benzoxepin-11-ylidene]propanenitrile |
| SMILES | C/C(C#N)=C1\c2ccc(Cc3c(C)nc4cc(C#C[Si](C)(C)C)ccn34)cc2COc2cc(F)ccc21 |
| InChI | InChI=1S/C31H28FN3OSi/c1-20(18-33)31-26-8-6-23(14-24(26)19-36-29-17-25(32)7-9-27(29)31)15-28-21(2)34-30-16-22(10-12-35(28)30)11-13-37(3,4)5/h6-10,12,14,16-17H,15,19H2,1-5H3/b31-20- |
| InChIKey | VTNPQVSCSCTEAE-GTWSWNCMSA-N |
| XLogP | 6.84 |
| TPSA | 50.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|