C10H13N3O4 — CID 90197659
[1-methyl-4-(pyrrolidine-1-carbonyl)pyrazol-5-yl] hydrogen carbonate (PubChem CID 90197659) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is [1-methyl-4-(pyrrolidine-1-carbonyl)pyrazol-5-yl] hydrogen carbonate.
| Compound Name | [1-methyl-4-(pyrrolidine-1-carbonyl)pyrazol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 90197659 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | [1-methyl-4-(pyrrolidine-1-carbonyl)pyrazol-5-yl] hydrogen carbonate |
| SMILES | Cn1ncc(C(=O)N2CCCC2)c1OC(=O)O |
| InChI | InChI=1S/C10H13N3O4/c1-12-9(17-10(15)16)7(6-11-12)8(14)13-4-2-3-5-13/h6H,2-5H2,1H3,(H,15,16) |
| InChIKey | OBLBEOOLQDUECY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |