C8H16O6 — CID 90202042
2-[2-[2-(2,2-dihydroxyethoxy)ethoxy]ethoxy]acetaldehyde (PubChem CID 90202042) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-[2-[2-(2,2-dihydroxyethoxy)ethoxy]ethoxy]acetaldehyde.
| Compound Name | 2-[2-[2-(2,2-dihydroxyethoxy)ethoxy]ethoxy]acetaldehyde |
|---|---|
| PubChem CID | 90202042 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-[2-[2-(2,2-dihydroxyethoxy)ethoxy]ethoxy]acetaldehyde |
| SMILES | O=CCOCCOCCOCC(O)O |
| InChI | InChI=1S/C8H16O6/c9-1-2-12-3-4-13-5-6-14-7-8(10)11/h1,8,10-11H,2-7H2 |
| InChIKey | XYTQSUSJBVKLCU-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|