C28H27N3O4 — CID 90202307
[2-[9-(cyclobutylmethyl)carbazol-3-yl]-1-(2-methoxyethyl)benzimidazol-5-yl] hydrogen carbonate (PubChem CID 90202307) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is [2-[9-(cyclobutylmethyl)carbazol-3-yl]-1-(2-methoxyethyl)benzimidazol-5-yl] hydrogen carbonate.
| Compound Name | [2-[9-(cyclobutylmethyl)carbazol-3-yl]-1-(2-methoxyethyl)benzimidazol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 90202307 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | [2-[9-(cyclobutylmethyl)carbazol-3-yl]-1-(2-methoxyethyl)benzimidazol-5-yl] hydrogen carbonate |
| SMILES | COCCn1c(-c2ccc3c(c2)c2ccccc2n3CC2CCC2)nc2cc(OC(=O)O)ccc21 |
| InChI | InChI=1S/C28H27N3O4/c1-34-14-13-30-26-12-10-20(35-28(32)33)16-23(26)29-27(30)19-9-11-25-22(15-19)21-7-2-3-8-24(21)31(25)17-18-5-4-6-18/h2-3,7-12,15-16,18H,4-6,13-14,17H2,1H3,(H,32,33) |
| InChIKey | WHXGSZVNKGJERI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|