C25H23N3O5S — CID 90202773
[2-(9-ethylcarbazol-3-yl)-1-(2-methylsulfonylethyl)benzimidazol-5-yl] hydrogen carbonate (PubChem CID 90202773) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is [2-(9-ethylcarbazol-3-yl)-1-(2-methylsulfonylethyl)benzimidazol-5-yl] hydrogen carbonate.
| Compound Name | [2-(9-ethylcarbazol-3-yl)-1-(2-methylsulfonylethyl)benzimidazol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 90202773 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | [2-(9-ethylcarbazol-3-yl)-1-(2-methylsulfonylethyl)benzimidazol-5-yl] hydrogen carbonate |
| SMILES | CCn1c2ccccc2c2cc(-c3nc4cc(OC(=O)O)ccc4n3CCS(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C25H23N3O5S/c1-3-27-21-7-5-4-6-18(21)19-14-16(8-10-22(19)27)24-26-20-15-17(33-25(29)30)9-11-23(20)28(24)12-13-34(2,31)32/h4-11,14-15H,3,12-13H2,1-2H3,(H,29,30) |
| InChIKey | QGTAEJVAKVMGBQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|