About (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine
(9-ethylcarbazol-2-yl) acetate;N-ethylethanamine (PubChem CID 89346724) has the molecular formula C20H26N2O2
and a molecular weight of 326.44 g/mol. Its IUPAC name is (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine.
Molecular Properties
| Compound Name | (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine |
| PubChem CID | 89346724 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine |
| SMILES | CCNCC.CCn1c2ccccc2c2ccc(OC(C)=O)cc21 |
| InChI | InChI=1S/C16H15NO2.C4H11N/c1-3-17-15-7-5-4-6-13(15)14-9-8-12(10-16(14)17)19-11(2)18;1-3-5-4-2/h4-10H,3H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | FXQLIRDIQWJOOG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine?
The IUPAC name of (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine (CID 89346724) is (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine.
What is the SMILES notation for (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine?
The canonical SMILES for (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine is CCNCC.CCn1c2ccccc2c2ccc(OC(C)=O)cc21.
What is the InChIKey of (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine?
The InChIKey is FXQLIRDIQWJOOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2.C4H11N/c1-3-17-15-7-5-4-6-13(15)14-9-8-12(10-16(14)17)19-11(2)18;1-3-5-4-2/h4-10H,3H2,1-2H3;5H,3-4H2,1-2H3.
What are the key properties of (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine?
(9-ethylcarbazol-2-yl) acetate;N-ethylethanamine has a molecular weight of 326.44 g/mol, XLogP of 4.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-ethylcarbazol-2-yl) acetate;N-ethylethanamine is sourced from PubChem (CID 89346724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).