C28H28N2O5 — CID 90203252
[(S)-[3-[[1-(4-formylbenzoyl)piperidin-4-yl]methoxy]phenyl]-phenylmethyl]carbamic acid (PubChem CID 90203252) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is [(S)-[3-[[1-(4-formylbenzoyl)piperidin-4-yl]methoxy]phenyl]-phenylmethyl]carbamic acid.
| Compound Name | [(S)-[3-[[1-(4-formylbenzoyl)piperidin-4-yl]methoxy]phenyl]-phenylmethyl]carbamic acid |
|---|---|
| PubChem CID | 90203252 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [(S)-[3-[[1-(4-formylbenzoyl)piperidin-4-yl]methoxy]phenyl]-phenylmethyl]carbamic acid |
| SMILES | O=Cc1ccc(C(=O)N2CCC(COc3cccc([C@@H](NC(=O)O)c4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C28H28N2O5/c31-18-20-9-11-23(12-10-20)27(32)30-15-13-21(14-16-30)19-35-25-8-4-7-24(17-25)26(29-28(33)34)22-5-2-1-3-6-22/h1-12,17-18,21,26,29H,13-16,19H2,(H,33,34)/t26-/m0/s1 |
| InChIKey | AMUODYMTLSWYAC-SANMLTNESA-N |
| XLogP | 4.79 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|