C20H22FN3O2S — CID 9020377
N-(3-fluorophenyl)-2-[4-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]piperazin-1-yl]acetamide (PubChem CID 9020377) has the molecular formula C20H22FN3O2S and a molecular weight of 387.48 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9020377 |
| Molecular Formula | C20H22FN3O2S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]piperazin-1-yl]acetamide |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCN(CC(=O)Nc3cccc(F)c3)CC2)s1 |
| InChI | InChI=1S/C20H22FN3O2S/c1-15-5-6-18(27-15)7-8-20(26)24-11-9-23(10-12-24)14-19(25)22-17-4-2-3-16(21)13-17/h2-8,13H,9-12,14H2,1H3,(H,22,25)/b8-7+ |
| InChIKey | ITPMIXUNQJLYLT-BQYQJAHWSA-N |
| XLogP | 2.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|