C21H22N2O2S — CID 9020477
N-[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-2-naphthalen-1-ylacetamide (PubChem CID 9020477) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 9020477 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-2-naphthalen-1-ylacetamide |
| SMILES | Cc1ccsc1CN(C)C(=O)CNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H22N2O2S/c1-15-10-11-26-19(15)14-23(2)21(25)13-22-20(24)12-17-8-5-7-16-6-3-4-9-18(16)17/h3-11H,12-14H2,1-2H3,(H,22,24) |
| InChIKey | LRJUCUSNSQLVLR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |